C16H15F3N2O2 — CID 144916386
(2Z,4Z)-2-(3-cyano-N-methylanilino)-4-(trifluoromethyl)hepta-2,4-dienoic acid (PubChem CID 144916386) has the molecular formula C16H15F3N2O2 and a molecular weight of 324.30 g/mol. Its IUPAC name is (2Z,4Z)-2-(3-cyano-N-methylanilino)-4-(trifluoromethyl)hepta-2,4-dienoic acid.
| Compound Name | (2Z,4Z)-2-(3-cyano-N-methylanilino)-4-(trifluoromethyl)hepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 144916386 |
| Molecular Formula | C16H15F3N2O2 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (2Z,4Z)-2-(3-cyano-N-methylanilino)-4-(trifluoromethyl)hepta-2,4-dienoic acid |
| SMILES | CC/C=C(/C=C(/C(=O)O)N(C)c1cccc(C#N)c1)C(F)(F)F |
| InChI | InChI=1S/C16H15F3N2O2/c1-3-5-12(16(17,18)19)9-14(15(22)23)21(2)13-7-4-6-11(8-13)10-20/h4-9H,3H2,1-2H3,(H,22,23)/b12-5-,14-9- |
| InChIKey | FDINMKHSBQQYBA-UQHMEREPSA-N |
| XLogP | 3.86 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|