C15H18N2 — CID 143269003
3-[[(2Z,4E)-hepta-2,4-dien-4-yl]-methylamino]benzonitrile (PubChem CID 143269003) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-[[(2Z,4E)-hepta-2,4-dien-4-yl]-methylamino]benzonitrile.
| Compound Name | 3-[[(2Z,4E)-hepta-2,4-dien-4-yl]-methylamino]benzonitrile |
|---|---|
| PubChem CID | 143269003 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 3-[[(2Z,4E)-hepta-2,4-dien-4-yl]-methylamino]benzonitrile |
| SMILES | C/C=C\C(=C/CC)N(C)c1cccc(C#N)c1 |
| InChI | InChI=1S/C15H18N2/c1-4-7-14(8-5-2)17(3)15-10-6-9-13(11-15)12-16/h4,6-11H,5H2,1-3H3/b7-4-,14-8+ |
| InChIKey | NPBHWTWIZMMORN-JCXIYKEOSA-N |
| XLogP | 3.86 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|