C38H33N3 — CID 143639561
3-(N-[4-[4-(N-[(2Z,4E)-hepta-2,4-dien-4-yl]anilino)phenyl]phenyl]anilino)benzonitrile (PubChem CID 143639561) has the molecular formula C38H33N3 and a molecular weight of 531.70 g/mol. Its IUPAC name is 3-(N-[4-[4-(N-[(2Z,4E)-hepta-2,4-dien-4-yl]anilino)phenyl]phenyl]anilino)benzonitrile.
| Compound Name | 3-(N-[4-[4-(N-[(2Z,4E)-hepta-2,4-dien-4-yl]anilino)phenyl]phenyl]anilino)benzonitrile |
|---|---|
| PubChem CID | 143639561 |
| Molecular Formula | C38H33N3 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 3-(N-[4-[4-(N-[(2Z,4E)-hepta-2,4-dien-4-yl]anilino)phenyl]phenyl]anilino)benzonitrile |
| SMILES | C/C=C\C(=C/CC)N(c1ccccc1)c1ccc(-c2ccc(N(c3ccccc3)c3cccc(C#N)c3)cc2)cc1 |
| InChI | InChI=1S/C38H33N3/c1-3-12-33(13-4-2)40(34-15-7-5-8-16-34)36-24-20-31(21-25-36)32-22-26-37(27-23-32)41(35-17-9-6-10-18-35)38-19-11-14-30(28-38)29-39/h3,5-28H,4H2,1-2H3/b12-3-,33-13+ |
| InChIKey | GGKSGWYZLIRFIY-VWKMBDJWSA-N |
| XLogP | 10.70 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|