C38H30N4 — CID 70805216
3-(N-[4-[4-(N-(3-methylphenyl)anilino)anilino]phenyl]anilino)benzonitrile (PubChem CID 70805216) has the molecular formula C38H30N4 and a molecular weight of 542.69 g/mol. Its IUPAC name is 3-(N-[4-[4-(N-(3-methylphenyl)anilino)anilino]phenyl]anilino)benzonitrile.
| Compound Name | 3-(N-[4-[4-(N-(3-methylphenyl)anilino)anilino]phenyl]anilino)benzonitrile |
|---|---|
| PubChem CID | 70805216 |
| Molecular Formula | C38H30N4 |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 3-(N-[4-[4-(N-(3-methylphenyl)anilino)anilino]phenyl]anilino)benzonitrile |
| SMILES | Cc1cccc(N(c2ccccc2)c2ccc(Nc3ccc(N(c4ccccc4)c4cccc(C#N)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C38H30N4/c1-29-10-8-16-37(26-29)41(33-12-4-2-5-13-33)35-22-18-31(19-23-35)40-32-20-24-36(25-21-32)42(34-14-6-3-7-15-34)38-17-9-11-30(27-38)28-39/h2-27,40H,1H3 |
| InChIKey | MZNABNHGOAQRDC-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 42.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |