C44H33N3 — CID 59431954
3-[N-methyl-4-[4-(3-phenyl-N-(3-phenylphenyl)anilino)phenyl]anilino]benzonitrile (PubChem CID 59431954) has the molecular formula C44H33N3 and a molecular weight of 603.77 g/mol. Its IUPAC name is 3-[N-methyl-4-[4-(3-phenyl-N-(3-phenylphenyl)anilino)phenyl]anilino]benzonitrile.
| Compound Name | 3-[N-methyl-4-[4-(3-phenyl-N-(3-phenylphenyl)anilino)phenyl]anilino]benzonitrile |
|---|---|
| PubChem CID | 59431954 |
| Molecular Formula | C44H33N3 |
| Molecular Weight | 603.77 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | 3-[N-methyl-4-[4-(3-phenyl-N-(3-phenylphenyl)anilino)phenyl]anilino]benzonitrile |
| SMILES | CN(c1ccc(-c2ccc(N(c3cccc(-c4ccccc4)c3)c3cccc(-c4ccccc4)c3)cc2)cc1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C44H33N3/c1-46(42-18-8-11-33(29-42)32-45)40-25-21-36(22-26-40)37-23-27-41(28-24-37)47(43-19-9-16-38(30-43)34-12-4-2-5-13-34)44-20-10-17-39(31-44)35-14-6-3-7-15-35/h2-31H,1H3 |
| InChIKey | NKGZADMCQGZARV-UHFFFAOYSA-N |
| XLogP | 11.80 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.77 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |