C32H26N3+ — CID 143684762
[4-(3-cyano-N-methylanilino)phenyl]-phenyl-(4-phenylphenyl)azanium (PubChem CID 143684762) has the molecular formula C32H26N3+ and a molecular weight of 452.58 g/mol. Its IUPAC name is [4-(3-cyano-N-methylanilino)phenyl]-phenyl-(4-phenylphenyl)azanium.
| Compound Name | [4-(3-cyano-N-methylanilino)phenyl]-phenyl-(4-phenylphenyl)azanium |
|---|---|
| PubChem CID | 143684762 |
| Molecular Formula | C32H26N3+ |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | [4-(3-cyano-N-methylanilino)phenyl]-phenyl-(4-phenylphenyl)azanium |
| SMILES | CN(c1ccc([NH+](c2ccccc2)c2ccc(-c3ccccc3)cc2)cc1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C32H25N3/c1-34(32-14-8-9-25(23-32)24-33)28-19-21-31(22-20-28)35(29-12-6-3-7-13-29)30-17-15-27(16-18-30)26-10-4-2-5-11-26/h2-23H,1H3/p+1 |
| InChIKey | AJWGRHGBRCLMQJ-UHFFFAOYSA-O |
| XLogP | 7.17 |
| TPSA | 31.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |