C14H11FN2 — CID 102816079
3-(4-fluoro-N-methylanilino)benzonitrile (PubChem CID 102816079) has the molecular formula C14H11FN2 and a molecular weight of 226.25 g/mol. Its IUPAC name is 3-(4-fluoro-N-methylanilino)benzonitrile.
| Compound Name | 3-(4-fluoro-N-methylanilino)benzonitrile |
|---|---|
| PubChem CID | 102816079 |
| Molecular Formula | C14H11FN2 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 3-(4-fluoro-N-methylanilino)benzonitrile |
| SMILES | CN(c1ccc(F)cc1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C14H11FN2/c1-17(13-7-5-12(15)6-8-13)14-4-2-3-11(9-14)10-16/h2-9H,1H3 |
| InChIKey | GHQOUSLPBSQMPS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |