C10H7F3N2O — CID 55209867
N-(3-cyanophenyl)-2,2,2-trifluoro-N-methylacetamide (PubChem CID 55209867) has the molecular formula C10H7F3N2O and a molecular weight of 228.17 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2,2,2-trifluoro-N-methylacetamide.
| Compound Name | N-(3-cyanophenyl)-2,2,2-trifluoro-N-methylacetamide |
|---|---|
| PubChem CID | 55209867 |
| Molecular Formula | C10H7F3N2O |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | N-(3-cyanophenyl)-2,2,2-trifluoro-N-methylacetamide |
| SMILES | CN(C(=O)C(F)(F)F)c1cccc(C#N)c1 |
| InChI | InChI=1S/C10H7F3N2O/c1-15(9(16)10(11,12)13)8-4-2-3-7(5-8)6-14/h2-5H,1H3 |
| InChIKey | XDQCABVFDPFBFB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |