C10H6F3N3O3 — CID 87972235
(3-cyanophenyl)-[(2,2,2-trifluoroacetyl)amino]carbamic acid (PubChem CID 87972235) has the molecular formula C10H6F3N3O3 and a molecular weight of 273.17 g/mol. Its IUPAC name is (3-cyanophenyl)-[(2,2,2-trifluoroacetyl)amino]carbamic acid.
| Compound Name | (3-cyanophenyl)-[(2,2,2-trifluoroacetyl)amino]carbamic acid |
|---|---|
| PubChem CID | 87972235 |
| Molecular Formula | C10H6F3N3O3 |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | (3-cyanophenyl)-[(2,2,2-trifluoroacetyl)amino]carbamic acid |
| SMILES | N#Cc1cccc(N(NC(=O)C(F)(F)F)C(=O)O)c1 |
| InChI | InChI=1S/C10H6F3N3O3/c11-10(12,13)8(17)15-16(9(18)19)7-3-1-2-6(4-7)5-14/h1-4H,(H,15,17)(H,18,19) |
| InChIKey | XWRMVAITGBXEEX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|