C14H11F3N2O2 — CID 144916501
(2Z,4Z)-2-(3-cyanoanilino)-4-(trifluoromethyl)hexa-2,4-dienoic acid (PubChem CID 144916501) has the molecular formula C14H11F3N2O2 and a molecular weight of 296.25 g/mol. Its IUPAC name is (2Z,4Z)-2-(3-cyanoanilino)-4-(trifluoromethyl)hexa-2,4-dienoic acid.
| Compound Name | (2Z,4Z)-2-(3-cyanoanilino)-4-(trifluoromethyl)hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 144916501 |
| Molecular Formula | C14H11F3N2O2 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | (2Z,4Z)-2-(3-cyanoanilino)-4-(trifluoromethyl)hexa-2,4-dienoic acid |
| SMILES | C/C=C(/C=C(\Nc1cccc(C#N)c1)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C14H11F3N2O2/c1-2-10(14(15,16)17)7-12(13(20)21)19-11-5-3-4-9(6-11)8-18/h2-7,19H,1H3,(H,20,21)/b10-2-,12-7- |
| InChIKey | ORBVHXIXOCXEBF-UHJGYOPMSA-N |
| XLogP | 3.45 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|