C17H14N4O — CID 58283045
1-(3-cyanophenyl)-3-(3-isocyanophenyl)-1,3-dimethylurea (PubChem CID 58283045) has the molecular formula C17H14N4O and a molecular weight of 290.33 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-(3-isocyanophenyl)-1,3-dimethylurea.
| Compound Name | 1-(3-cyanophenyl)-3-(3-isocyanophenyl)-1,3-dimethylurea |
|---|---|
| PubChem CID | 58283045 |
| Molecular Formula | C17H14N4O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-(3-cyanophenyl)-3-(3-isocyanophenyl)-1,3-dimethylurea |
| SMILES | [C-]#[N+]c1cccc(N(C)C(=O)N(C)c2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C17H14N4O/c1-19-14-7-5-9-16(11-14)21(3)17(22)20(2)15-8-4-6-13(10-15)12-18/h4-11H,2-3H3 |
| InChIKey | QSORROATSDZZQM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 51.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|