C16H20N2O2 — CID 65156211
N-(3-cyanophenyl)-N,2,4,5-tetramethyloxolane-3-carboxamide (PubChem CID 65156211) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-(3-cyanophenyl)-N,2,4,5-tetramethyloxolane-3-carboxamide.
| Compound Name | N-(3-cyanophenyl)-N,2,4,5-tetramethyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 65156211 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-(3-cyanophenyl)-N,2,4,5-tetramethyloxolane-3-carboxamide |
| SMILES | CC1OC(C)C(C(=O)N(C)c2cccc(C#N)c2)C1C |
| InChI | InChI=1S/C16H20N2O2/c1-10-11(2)20-12(3)15(10)16(19)18(4)14-7-5-6-13(8-14)9-17/h5-8,10-12,15H,1-4H3 |
| InChIKey | FJTUWQNBVDQBQI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |