About N-(3-cyanophenyl)-N,2,2-trimethylcyclopentane-1-carboxamide
N-(3-cyanophenyl)-N,2,2-trimethylcyclopentane-1-carboxamide (PubChem CID 104917093) has the molecular formula C16H20N2O
and a molecular weight of 256.35 g/mol. Its IUPAC name is N-(3-cyanophenyl)-N,2,2-trimethylcyclopentane-1-carboxamide.
Molecular Properties
| Compound Name | N-(3-cyanophenyl)-N,2,2-trimethylcyclopentane-1-carboxamide |
| PubChem CID | 104917093 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N-(3-cyanophenyl)-N,2,2-trimethylcyclopentane-1-carboxamide |
| SMILES | CN(C(=O)C1CCCC1(C)C)c1cccc(C#N)c1 |
| InChI | InChI=1S/C16H20N2O/c1-16(2)9-5-8-14(16)15(19)18(3)13-7-4-6-12(10-13)11-17/h4,6-7,10,14H,5,8-9H2,1-3H3 |
| InChIKey | VFKUFMDFOWONAT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-cyanophenyl)-N,2,2-trimethylcyclopentane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-cyanophenyl)-N,2,2-trimethylcyclopentane-1-carboxamide?
The IUPAC name of N-(3-cyanophenyl)-N,2,2-trimethylcyclopentane-1-carboxamide (CID 104917093) is N-(3-cyanophenyl)-N,2,2-trimethylcyclopentane-1-carboxamide.
What is the SMILES notation for N-(3-cyanophenyl)-N,2,2-trimethylcyclopentane-1-carboxamide?
The canonical SMILES for N-(3-cyanophenyl)-N,2,2-trimethylcyclopentane-1-carboxamide is CN(C(=O)C1CCCC1(C)C)c1cccc(C#N)c1.
What is the InChIKey of N-(3-cyanophenyl)-N,2,2-trimethylcyclopentane-1-carboxamide?
The InChIKey is VFKUFMDFOWONAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O/c1-16(2)9-5-8-14(16)15(19)18(3)13-7-4-6-12(10-13)11-17/h4,6-7,10,14H,5,8-9H2,1-3H3.
What are the key properties of N-(3-cyanophenyl)-N,2,2-trimethylcyclopentane-1-carboxamide?
N-(3-cyanophenyl)-N,2,2-trimethylcyclopentane-1-carboxamide has a molecular weight of 256.35 g/mol, XLogP of 3.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-cyanophenyl)-N,2,2-trimethylcyclopentane-1-carboxamide is sourced from PubChem (CID 104917093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).