C35H40F3N3O — CID 144916701
N,N-dimethyl-1-(3-methylphenyl)-1-phenylmethanamine;3-[methyl-[(5Z,7Z)-4-oxo-7-(trifluoromethyl)deca-5,7-dien-5-yl]amino]benzonitrile (PubChem CID 144916701) has the molecular formula C35H40F3N3O and a molecular weight of 575.72 g/mol. Its IUPAC name is N,N-dimethyl-1-(3-methylphenyl)-1-phenylmethanamine;3-[methyl-[(5Z,7Z)-4-oxo-7-(trifluoromethyl)deca-5,7-dien-5-yl]amino]benzonitrile.
| Compound Name | N,N-dimethyl-1-(3-methylphenyl)-1-phenylmethanamine;3-[methyl-[(5Z,7Z)-4-oxo-7-(trifluoromethyl)deca-5,7-dien-5-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 144916701 |
| Molecular Formula | C35H40F3N3O |
| Molecular Weight | 575.72 g/mol |
| Exact Mass | 575.31 |
| IUPAC Name | N,N-dimethyl-1-(3-methylphenyl)-1-phenylmethanamine;3-[methyl-[(5Z,7Z)-4-oxo-7-(trifluoromethyl)deca-5,7-dien-5-yl]amino]benzonitrile |
| SMILES | CC/C=C(/C=C(/C(=O)CCC)N(C)c1cccc(C#N)c1)C(F)(F)F.Cc1cccc(C(c2ccccc2)N(C)C)c1 |
| InChI | InChI=1S/C19H21F3N2O.C16H19N/c1-4-7-15(19(20,21)22)12-17(18(25)8-5-2)24(3)16-10-6-9-14(11-16)13-23;1-13-8-7-11-15(12-13)16(17(2)3)14-9-5-4-6-10-14/h6-7,9-12H,4-5,8H2,1-3H3;4-12,16H,1-3H3/b15-7-,17-12-; |
| InChIKey | BRODJQRMGGDWPP-NOPSSEKRSA-N |
| XLogP | 8.79 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.72 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|