C34H35F3N4O2 — CID 123248432
2-(3-cyano-N-methylanilino)-N-[3-[(oxolan-2-ylmethylamino)-phenylmethyl]phenyl]-4-(trifluoromethyl)hepta-2,4-dienamide (PubChem CID 123248432) has the molecular formula C34H35F3N4O2 and a molecular weight of 588.67 g/mol. Its IUPAC name is 2-(3-cyano-N-methylanilino)-N-[3-[(oxolan-2-ylmethylamino)-phenylmethyl]phenyl]-4-(trifluoromethyl)hepta-2,4-dienamide.
| Compound Name | 2-(3-cyano-N-methylanilino)-N-[3-[(oxolan-2-ylmethylamino)-phenylmethyl]phenyl]-4-(trifluoromethyl)hepta-2,4-dienamide |
|---|---|
| PubChem CID | 123248432 |
| Molecular Formula | C34H35F3N4O2 |
| Molecular Weight | 588.67 g/mol |
| Exact Mass | 588.27 |
| IUPAC Name | 2-(3-cyano-N-methylanilino)-N-[3-[(oxolan-2-ylmethylamino)-phenylmethyl]phenyl]-4-(trifluoromethyl)hepta-2,4-dienamide |
| SMILES | CCC=C(C=C(C(=O)Nc1cccc(C(NCC2CCCO2)c2ccccc2)c1)N(C)c1cccc(C#N)c1)C(F)(F)F |
| InChI | InChI=1S/C34H35F3N4O2/c1-3-10-27(34(35,36)37)21-31(41(2)29-16-7-11-24(19-29)22-38)33(42)40-28-15-8-14-26(20-28)32(25-12-5-4-6-13-25)39-23-30-17-9-18-43-30/h4-8,10-16,19-21,30,32,39H,3,9,17-18,23H2,1-2H3,(H,40,42) |
| InChIKey | QSLRALXNSACCFB-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.67 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|