C21H31F3N2O — CID 144917149
(5Z,7Z)-5-[3-(aminomethyl)-N-methylanilino]-7-(trifluoromethyl)deca-5,7-dien-4-one;ethane (PubChem CID 144917149) has the molecular formula C21H31F3N2O and a molecular weight of 384.49 g/mol. Its IUPAC name is (5Z,7Z)-5-[3-(aminomethyl)-N-methylanilino]-7-(trifluoromethyl)deca-5,7-dien-4-one;ethane.
| Compound Name | (5Z,7Z)-5-[3-(aminomethyl)-N-methylanilino]-7-(trifluoromethyl)deca-5,7-dien-4-one;ethane |
|---|---|
| PubChem CID | 144917149 |
| Molecular Formula | C21H31F3N2O |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | (5Z,7Z)-5-[3-(aminomethyl)-N-methylanilino]-7-(trifluoromethyl)deca-5,7-dien-4-one;ethane |
| SMILES | CC.CC/C=C(/C=C(/C(=O)CCC)N(C)c1cccc(CN)c1)C(F)(F)F |
| InChI | InChI=1S/C19H25F3N2O.C2H6/c1-4-7-15(19(20,21)22)12-17(18(25)8-5-2)24(3)16-10-6-9-14(11-16)13-23;1-2/h6-7,9-12H,4-5,8,13,23H2,1-3H3;1-2H3/b15-7-,17-12-; |
| InChIKey | VCHFUEMSNITBFW-NOPSSEKRSA-N |
| XLogP | 5.76 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|