C9H12N2OS — CID 174643734
[3-(aminomethyl)phenyl]-methylcarbamothioic S-acid (PubChem CID 174643734) has the molecular formula C9H12N2OS and a molecular weight of 196.28 g/mol. Its IUPAC name is [3-(aminomethyl)phenyl]-methylcarbamothioic S-acid.
| Compound Name | [3-(aminomethyl)phenyl]-methylcarbamothioic S-acid |
|---|---|
| PubChem CID | 174643734 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | [3-(aminomethyl)phenyl]-methylcarbamothioic S-acid |
| SMILES | CN(C(=O)S)c1cccc(CN)c1 |
| InChI | InChI=1S/C9H12N2OS/c1-11(9(12)13)8-4-2-3-7(5-8)6-10/h2-5H,6,10H2,1H3,(H,12,13) |
| InChIKey | ZYRBCJOJOLEPKP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|