C8H13N3O2S — CID 114958620
1-(aminomethyl)-3-[methyl(sulfamoyl)amino]benzene (PubChem CID 114958620) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is 1-(aminomethyl)-3-[methyl(sulfamoyl)amino]benzene.
| Compound Name | 1-(aminomethyl)-3-[methyl(sulfamoyl)amino]benzene |
|---|---|
| PubChem CID | 114958620 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 1-(aminomethyl)-3-[methyl(sulfamoyl)amino]benzene |
| SMILES | CN(c1cccc(CN)c1)S(N)(=O)=O |
| InChI | InChI=1S/C8H13N3O2S/c1-11(14(10,12)13)8-4-2-3-7(5-8)6-9/h2-5H,6,9H2,1H3,(H2,10,12,13) |
| InChIKey | GFYIBIUTZSXDBH-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |