C8H12N2O3S — CID 112573732
1-methoxy-3-[methyl(sulfamoyl)amino]benzene (PubChem CID 112573732) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is 1-methoxy-3-[methyl(sulfamoyl)amino]benzene.
| Compound Name | 1-methoxy-3-[methyl(sulfamoyl)amino]benzene |
|---|---|
| PubChem CID | 112573732 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 1-methoxy-3-[methyl(sulfamoyl)amino]benzene |
| SMILES | COc1cccc(N(C)S(N)(=O)=O)c1 |
| InChI | InChI=1S/C8H12N2O3S/c1-10(14(9,11)12)7-4-3-5-8(6-7)13-2/h3-6H,1-2H3,(H2,9,11,12) |
| InChIKey | TXAVIDXXCJNIBY-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |