C11H19N3O3S — CID 28769805
N'-(dimethylsulfamoyl)-N'-(3-methoxyphenyl)ethane-1,2-diamine (PubChem CID 28769805) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is N'-(dimethylsulfamoyl)-N'-(3-methoxyphenyl)ethane-1,2-diamine.
| Compound Name | N'-(dimethylsulfamoyl)-N'-(3-methoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 28769805 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N'-(dimethylsulfamoyl)-N'-(3-methoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1cccc(N(CCN)S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C11H19N3O3S/c1-13(2)18(15,16)14(8-7-12)10-5-4-6-11(9-10)17-3/h4-6,9H,7-8,12H2,1-3H3 |
| InChIKey | QMAQLZWEOMPOAZ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |