C14H25N3O3S — CID 114803421
1-[3-aminopropyl(tert-butylsulfamoyl)amino]-3-methoxybenzene (PubChem CID 114803421) has the molecular formula C14H25N3O3S and a molecular weight of 315.44 g/mol. Its IUPAC name is 1-[3-aminopropyl(tert-butylsulfamoyl)amino]-3-methoxybenzene.
| Compound Name | 1-[3-aminopropyl(tert-butylsulfamoyl)amino]-3-methoxybenzene |
|---|---|
| PubChem CID | 114803421 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1-[3-aminopropyl(tert-butylsulfamoyl)amino]-3-methoxybenzene |
| SMILES | COc1cccc(N(CCCN)S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C14H25N3O3S/c1-14(2,3)16-21(18,19)17(10-6-9-15)12-7-5-8-13(11-12)20-4/h5,7-8,11,16H,6,9-10,15H2,1-4H3 |
| InChIKey | YVAGZFISKSRWIZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |