About N,N-dimethylaniline;phenylmethanamine
N,N-dimethylaniline;phenylmethanamine (PubChem CID 159620878) has the molecular formula C15H20N2
and a molecular weight of 228.34 g/mol. Its IUPAC name is N,N-dimethylaniline;phenylmethanamine.
Molecular Properties
| Compound Name | N,N-dimethylaniline;phenylmethanamine |
| PubChem CID | 159620878 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | N,N-dimethylaniline;phenylmethanamine |
| SMILES | CN(C)c1ccccc1.NCc1ccccc1 |
| InChI | InChI=1S/C8H11N.C7H9N/c1-9(2)8-6-4-3-5-7-8;8-6-7-4-2-1-3-5-7/h3-7H,1-2H3;1-5H,6,8H2 |
| InChIKey | MNWHEINDSPXJFN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethylaniline;phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylaniline;phenylmethanamine?
The IUPAC name of N,N-dimethylaniline;phenylmethanamine (CID 159620878) is N,N-dimethylaniline;phenylmethanamine.
What is the SMILES notation for N,N-dimethylaniline;phenylmethanamine?
The canonical SMILES for N,N-dimethylaniline;phenylmethanamine is CN(C)c1ccccc1.NCc1ccccc1.
What is the InChIKey of N,N-dimethylaniline;phenylmethanamine?
The InChIKey is MNWHEINDSPXJFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C7H9N/c1-9(2)8-6-4-3-5-7-8;8-6-7-4-2-1-3-5-7/h3-7H,1-2H3;1-5H,6,8H2.
What are the key properties of N,N-dimethylaniline;phenylmethanamine?
N,N-dimethylaniline;phenylmethanamine has a molecular weight of 228.34 g/mol, XLogP of 2.90, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylaniline;phenylmethanamine is sourced from PubChem (CID 159620878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).