C10H20Cl2N2 — CID 123134602
4-(aminomethyl)-N,N-dimethylaniline;methane;dihydrochloride (PubChem CID 123134602) has the molecular formula C10H20Cl2N2 and a molecular weight of 239.19 g/mol. Its IUPAC name is 4-(aminomethyl)-N,N-dimethylaniline;methane;dihydrochloride.
| Compound Name | 4-(aminomethyl)-N,N-dimethylaniline;methane;dihydrochloride |
|---|---|
| PubChem CID | 123134602 |
| Molecular Formula | C10H20Cl2N2 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 4-(aminomethyl)-N,N-dimethylaniline;methane;dihydrochloride |
| SMILES | C.CN(C)c1ccc(CN)cc1.Cl.Cl |
| InChI | InChI=1S/C9H14N2.CH4.2ClH/c1-11(2)9-5-3-8(7-10)4-6-9;;;/h3-6H,7,10H2,1-2H3;1H4;2*1H |
| InChIKey | KSPVDVRRORQSHB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|