C12H16N2O — CID 62970436
N-[3-(aminomethyl)phenyl]-N-methylcyclopropanecarboxamide (PubChem CID 62970436) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is N-[3-(aminomethyl)phenyl]-N-methylcyclopropanecarboxamide.
| Compound Name | N-[3-(aminomethyl)phenyl]-N-methylcyclopropanecarboxamide |
|---|---|
| PubChem CID | 62970436 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | N-[3-(aminomethyl)phenyl]-N-methylcyclopropanecarboxamide |
| SMILES | CN(C(=O)C1CC1)c1cccc(CN)c1 |
| InChI | InChI=1S/C12H16N2O/c1-14(12(15)10-5-6-10)11-4-2-3-9(7-11)8-13/h2-4,7,10H,5-6,8,13H2,1H3 |
| InChIKey | PZYOBRRXKGWTMR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |