C16H21F3N2 — CID 144917001
3-(aminomethyl)-N-methyl-N-[(2Z,4Z)-4-(trifluoromethyl)hepta-2,4-dien-2-yl]aniline (PubChem CID 144917001) has the molecular formula C16H21F3N2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 3-(aminomethyl)-N-methyl-N-[(2Z,4Z)-4-(trifluoromethyl)hepta-2,4-dien-2-yl]aniline.
| Compound Name | 3-(aminomethyl)-N-methyl-N-[(2Z,4Z)-4-(trifluoromethyl)hepta-2,4-dien-2-yl]aniline |
|---|---|
| PubChem CID | 144917001 |
| Molecular Formula | C16H21F3N2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 3-(aminomethyl)-N-methyl-N-[(2Z,4Z)-4-(trifluoromethyl)hepta-2,4-dien-2-yl]aniline |
| SMILES | CC/C=C(/C=C(/C)N(C)c1cccc(CN)c1)C(F)(F)F |
| InChI | InChI=1S/C16H21F3N2/c1-4-6-14(16(17,18)19)9-12(2)21(3)15-8-5-7-13(10-15)11-20/h5-10H,4,11,20H2,1-3H3/b12-9-,14-6- |
| InChIKey | VEYVBGSZDRNXAV-BWYGLISWSA-N |
| XLogP | 4.38 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|