C16H19F3N2O — CID 144916220
(2Z,4Z)-2-[3-(aminomethyl)-N-methylanilino]-4-(trifluoromethyl)hepta-2,4-dienal (PubChem CID 144916220) has the molecular formula C16H19F3N2O and a molecular weight of 312.34 g/mol. Its IUPAC name is (2Z,4Z)-2-[3-(aminomethyl)-N-methylanilino]-4-(trifluoromethyl)hepta-2,4-dienal.
| Compound Name | (2Z,4Z)-2-[3-(aminomethyl)-N-methylanilino]-4-(trifluoromethyl)hepta-2,4-dienal |
|---|---|
| PubChem CID | 144916220 |
| Molecular Formula | C16H19F3N2O |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (2Z,4Z)-2-[3-(aminomethyl)-N-methylanilino]-4-(trifluoromethyl)hepta-2,4-dienal |
| SMILES | CC/C=C(/C=C(/C=O)N(C)c1cccc(CN)c1)C(F)(F)F |
| InChI | InChI=1S/C16H19F3N2O/c1-3-5-13(16(17,18)19)9-15(11-22)21(2)14-7-4-6-12(8-14)10-20/h4-9,11H,3,10,20H2,1-2H3/b13-5-,15-9- |
| InChIKey | BOCQIUBCRLNOFD-GVKLBPNGSA-N |
| XLogP | 3.56 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|