C15H15F2N3O — CID 62970793
1-[3-(aminomethyl)phenyl]-3-(2,4-difluorophenyl)-1-methylurea (PubChem CID 62970793) has the molecular formula C15H15F2N3O and a molecular weight of 291.30 g/mol. Its IUPAC name is 1-[3-(aminomethyl)phenyl]-3-(2,4-difluorophenyl)-1-methylurea.
| Compound Name | 1-[3-(aminomethyl)phenyl]-3-(2,4-difluorophenyl)-1-methylurea |
|---|---|
| PubChem CID | 62970793 |
| Molecular Formula | C15H15F2N3O |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 1-[3-(aminomethyl)phenyl]-3-(2,4-difluorophenyl)-1-methylurea |
| SMILES | CN(C(=O)Nc1ccc(F)cc1F)c1cccc(CN)c1 |
| InChI | InChI=1S/C15H15F2N3O/c1-20(12-4-2-3-10(7-12)9-18)15(21)19-14-6-5-11(16)8-13(14)17/h2-8H,9,18H2,1H3,(H,19,21) |
| InChIKey | RHTDFYGFENVYOZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |