C12H8F3N — CID 89319358
3-[(1E)-3-(trifluoromethyl)buta-1,3-dienyl]benzonitrile (PubChem CID 89319358) has the molecular formula C12H8F3N and a molecular weight of 223.20 g/mol. Its IUPAC name is 3-[(1E)-3-(trifluoromethyl)buta-1,3-dienyl]benzonitrile.
| Compound Name | 3-[(1E)-3-(trifluoromethyl)buta-1,3-dienyl]benzonitrile |
|---|---|
| PubChem CID | 89319358 |
| Molecular Formula | C12H8F3N |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 3-[(1E)-3-(trifluoromethyl)buta-1,3-dienyl]benzonitrile |
| SMILES | C=C(/C=C/c1cccc(C#N)c1)C(F)(F)F |
| InChI | InChI=1S/C12H8F3N/c1-9(12(13,14)15)5-6-10-3-2-4-11(7-10)8-16/h2-7H,1H2/b6-5+ |
| InChIKey | XCAKJHDSNCSVRK-AATRIKPKSA-N |
| XLogP | 3.69 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|