About 3-but-1-enylbenzonitrile
3-but-1-enylbenzonitrile (PubChem CID 66844628) has the molecular formula C11H11N
and a molecular weight of 157.22 g/mol. Its IUPAC name is 3-but-1-enylbenzonitrile.
Molecular Properties
| Compound Name | 3-but-1-enylbenzonitrile |
| PubChem CID | 66844628 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 3-but-1-enylbenzonitrile |
| SMILES | CCC=Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C11H11N/c1-2-3-5-10-6-4-7-11(8-10)9-12/h3-8H,2H2,1H3 |
| InChIKey | MPJAYWIXCKOYBG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-but-1-enylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-1-enylbenzonitrile?
The IUPAC name of 3-but-1-enylbenzonitrile (CID 66844628) is 3-but-1-enylbenzonitrile.
What is the SMILES notation for 3-but-1-enylbenzonitrile?
The canonical SMILES for 3-but-1-enylbenzonitrile is CCC=Cc1cccc(C#N)c1.
What is the InChIKey of 3-but-1-enylbenzonitrile?
The InChIKey is MPJAYWIXCKOYBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N/c1-2-3-5-10-6-4-7-11(8-10)9-12/h3-8H,2H2,1H3.
What are the key properties of 3-but-1-enylbenzonitrile?
3-but-1-enylbenzonitrile has a molecular weight of 157.22 g/mol, XLogP of 2.98, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-1-enylbenzonitrile is sourced from PubChem (CID 66844628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).