About 3-formylbenzonitrile;propanal
3-formylbenzonitrile;propanal (PubChem CID 174810300) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is 3-formylbenzonitrile;propanal.
Molecular Properties
| Compound Name | 3-formylbenzonitrile;propanal |
| PubChem CID | 174810300 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 3-formylbenzonitrile;propanal |
| SMILES | CCC=O.N#Cc1cccc(C=O)c1 |
| InChI | InChI=1S/C8H5NO.C3H6O/c9-5-7-2-1-3-8(4-7)6-10;1-2-3-4/h1-4,6H;3H,2H2,1H3 |
| InChIKey | FIZZRZINRTWRDD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-formylbenzonitrile;propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-formylbenzonitrile;propanal?
The IUPAC name of 3-formylbenzonitrile;propanal (CID 174810300) is 3-formylbenzonitrile;propanal.
What is the SMILES notation for 3-formylbenzonitrile;propanal?
The canonical SMILES for 3-formylbenzonitrile;propanal is CCC=O.N#Cc1cccc(C=O)c1.
What is the InChIKey of 3-formylbenzonitrile;propanal?
The InChIKey is FIZZRZINRTWRDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO.C3H6O/c9-5-7-2-1-3-8(4-7)6-10;1-2-3-4/h1-4,6H;3H,2H2,1H3.
What are the key properties of 3-formylbenzonitrile;propanal?
3-formylbenzonitrile;propanal has a molecular weight of 189.21 g/mol, XLogP of 1.97, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-formylbenzonitrile;propanal is sourced from PubChem (CID 174810300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).