C28H28N2O2 — CID 144917091
3-[[(3Z)-5-methyl-2-oxohexa-3,5-dien-3-yl]amino]benzonitrile;(3-methylphenyl)-phenylmethanol (PubChem CID 144917091) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is 3-[[(3Z)-5-methyl-2-oxohexa-3,5-dien-3-yl]amino]benzonitrile;(3-methylphenyl)-phenylmethanol.
| Compound Name | 3-[[(3Z)-5-methyl-2-oxohexa-3,5-dien-3-yl]amino]benzonitrile;(3-methylphenyl)-phenylmethanol |
|---|---|
| PubChem CID | 144917091 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 3-[[(3Z)-5-methyl-2-oxohexa-3,5-dien-3-yl]amino]benzonitrile;(3-methylphenyl)-phenylmethanol |
| SMILES | C=C(C)/C=C(\Nc1cccc(C#N)c1)C(C)=O.Cc1cccc(C(O)c2ccccc2)c1 |
| InChI | InChI=1S/C14H14N2O.C14H14O/c1-10(2)7-14(11(3)17)16-13-6-4-5-12(8-13)9-15;1-11-6-5-9-13(10-11)14(15)12-7-3-2-4-8-12/h4-8,16H,1H2,2-3H3;2-10,14-15H,1H3/b14-7-; |
| InChIKey | MPFDGBYGMQBEGI-KIUKIJHYSA-N |
| XLogP | 6.10 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|