C22H29FN2O — CID 144916872
1-[3-cyclopropyl-1-[4-fluoro-3-(prop-1-en-2-ylamino)phenyl]propyl]pyridin-2-one;ethane (PubChem CID 144916872) has the molecular formula C22H29FN2O and a molecular weight of 356.49 g/mol. Its IUPAC name is 1-[3-cyclopropyl-1-[4-fluoro-3-(prop-1-en-2-ylamino)phenyl]propyl]pyridin-2-one;ethane.
| Compound Name | 1-[3-cyclopropyl-1-[4-fluoro-3-(prop-1-en-2-ylamino)phenyl]propyl]pyridin-2-one;ethane |
|---|---|
| PubChem CID | 144916872 |
| Molecular Formula | C22H29FN2O |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 1-[3-cyclopropyl-1-[4-fluoro-3-(prop-1-en-2-ylamino)phenyl]propyl]pyridin-2-one;ethane |
| SMILES | C=C(C)Nc1cc(C(CCC2CC2)n2ccccc2=O)ccc1F.CC |
| InChI | InChI=1S/C20H23FN2O.C2H6/c1-14(2)22-18-13-16(9-10-17(18)21)19(11-8-15-6-7-15)23-12-4-3-5-20(23)24;1-2/h3-5,9-10,12-13,15,19,22H,1,6-8,11H2,2H3;1-2H3 |
| InChIKey | JGFISILALNQMBA-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |