C33H31F4N5O — CID 144916320
(2Z)-N-[5-[1-amino-1-(4-cyanophenyl)-3-cyclopropylpropyl]-2-fluorophenyl]-2-(3-ethanimidoylanilino)-4-(trifluoromethyl)penta-2,4-dienamide (PubChem CID 144916320) has the molecular formula C33H31F4N5O and a molecular weight of 589.64 g/mol. Its IUPAC name is (2Z)-N-[5-[1-amino-1-(4-cyanophenyl)-3-cyclopropylpropyl]-2-fluorophenyl]-2-(3-ethanimidoylanilino)-4-(trifluoromethyl)penta-2,4-dienamide.
| Compound Name | (2Z)-N-[5-[1-amino-1-(4-cyanophenyl)-3-cyclopropylpropyl]-2-fluorophenyl]-2-(3-ethanimidoylanilino)-4-(trifluoromethyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 144916320 |
| Molecular Formula | C33H31F4N5O |
| Molecular Weight | 589.64 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | (2Z)-N-[5-[1-amino-1-(4-cyanophenyl)-3-cyclopropylpropyl]-2-fluorophenyl]-2-(3-ethanimidoylanilino)-4-(trifluoromethyl)penta-2,4-dienamide |
| SMILES | [H]/N=C(\C)c1cccc(N/C(=C\C(=C)C(F)(F)F)C(=O)Nc2cc(C(N)(CCC3CC3)c3ccc(C#N)cc3)ccc2F)c1 |
| InChI | InChI=1S/C33H31F4N5O/c1-20(33(35,36)37)16-30(41-27-5-3-4-24(17-27)21(2)39)31(43)42-29-18-26(12-13-28(29)34)32(40,15-14-22-6-7-22)25-10-8-23(19-38)9-11-25/h3-5,8-13,16-18,22,39,41H,1,6-7,14-15,40H2,2H3,(H,42,43)/b30-16-,39-21+ |
| InChIKey | OXFYHZJHMXALIG-VAPSPGCESA-N |
| XLogP | 7.53 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.64 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|