C33H37F3N2O2 — CID 144916195
(3Z)-3-[3-(aminomethyl)anilino]-5-(trifluoromethyl)hexa-3,5-dien-2-one;1-[2-cyclopropylethoxy(phenyl)methyl]-3-methylbenzene (PubChem CID 144916195) has the molecular formula C33H37F3N2O2 and a molecular weight of 550.67 g/mol. Its IUPAC name is (3Z)-3-[3-(aminomethyl)anilino]-5-(trifluoromethyl)hexa-3,5-dien-2-one;1-[2-cyclopropylethoxy(phenyl)methyl]-3-methylbenzene.
| Compound Name | (3Z)-3-[3-(aminomethyl)anilino]-5-(trifluoromethyl)hexa-3,5-dien-2-one;1-[2-cyclopropylethoxy(phenyl)methyl]-3-methylbenzene |
|---|---|
| PubChem CID | 144916195 |
| Molecular Formula | C33H37F3N2O2 |
| Molecular Weight | 550.67 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | (3Z)-3-[3-(aminomethyl)anilino]-5-(trifluoromethyl)hexa-3,5-dien-2-one;1-[2-cyclopropylethoxy(phenyl)methyl]-3-methylbenzene |
| SMILES | C=C(/C=C(\Nc1cccc(CN)c1)C(C)=O)C(F)(F)F.Cc1cccc(C(OCCC2CC2)c2ccccc2)c1 |
| InChI | InChI=1S/C19H22O.C14H15F3N2O/c1-15-6-5-9-18(14-15)19(17-7-3-2-4-8-17)20-13-12-16-10-11-16;1-9(14(15,16)17)6-13(10(2)20)19-12-5-3-4-11(7-12)8-18/h2-9,14,16,19H,10-13H2,1H3;3-7,19H,1,8,18H2,2H3/b;13-6- |
| InChIKey | JLULXGJIUXRWHP-KZWXERBNSA-N |
| XLogP | 8.05 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.67 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|