C18H20N2O — CID 144916276
N-(cyclopropylmethyl)-1-(3-methylphenyl)-1-(4-nitrosophenyl)methanamine (PubChem CID 144916276) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1-(3-methylphenyl)-1-(4-nitrosophenyl)methanamine.
| Compound Name | N-(cyclopropylmethyl)-1-(3-methylphenyl)-1-(4-nitrosophenyl)methanamine |
|---|---|
| PubChem CID | 144916276 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N-(cyclopropylmethyl)-1-(3-methylphenyl)-1-(4-nitrosophenyl)methanamine |
| SMILES | Cc1cccc(C(NCC2CC2)c2ccc(N=O)cc2)c1 |
| InChI | InChI=1S/C18H20N2O/c1-13-3-2-4-16(11-13)18(19-12-14-5-6-14)15-7-9-17(20-21)10-8-15/h2-4,7-11,14,18-19H,5-6,12H2,1H3 |
| InChIKey | CCECBKAGEMGMNR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |