C18H17ClFN5 — CID 67996840
1-(4-chlorophenyl)-N-(cyclopropylmethyl)-1-[1-(2-fluorophenyl)tetrazol-5-yl]methanamine (PubChem CID 67996840) has the molecular formula C18H17ClFN5 and a molecular weight of 357.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(cyclopropylmethyl)-1-[1-(2-fluorophenyl)tetrazol-5-yl]methanamine.
| Compound Name | 1-(4-chlorophenyl)-N-(cyclopropylmethyl)-1-[1-(2-fluorophenyl)tetrazol-5-yl]methanamine |
|---|---|
| PubChem CID | 67996840 |
| Molecular Formula | C18H17ClFN5 |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(cyclopropylmethyl)-1-[1-(2-fluorophenyl)tetrazol-5-yl]methanamine |
| SMILES | Fc1ccccc1-n1nnnc1C(NCC1CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17ClFN5/c19-14-9-7-13(8-10-14)17(21-11-12-5-6-12)18-22-23-24-25(18)16-4-2-1-3-15(16)20/h1-4,7-10,12,17,21H,5-6,11H2 |
| InChIKey | OKYZAJOOLYXSQD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |