C12H15Cl2N5O — CID 103084978
1-[1-(2,4-dichlorophenyl)tetrazol-5-yl]-N-(2-methoxyethyl)ethanamine (PubChem CID 103084978) has the molecular formula C12H15Cl2N5O and a molecular weight of 316.19 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)tetrazol-5-yl]-N-(2-methoxyethyl)ethanamine.
| Compound Name | 1-[1-(2,4-dichlorophenyl)tetrazol-5-yl]-N-(2-methoxyethyl)ethanamine |
|---|---|
| PubChem CID | 103084978 |
| Molecular Formula | C12H15Cl2N5O |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)tetrazol-5-yl]-N-(2-methoxyethyl)ethanamine |
| SMILES | COCCNC(C)c1nnnn1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H15Cl2N5O/c1-8(15-5-6-20-2)12-16-17-18-19(12)11-4-3-9(13)7-10(11)14/h3-4,7-8,15H,5-6H2,1-2H3 |
| InChIKey | FCSGOOBCIZWLGS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|