C11H12BrCl2N5 — CID 107794149
1-[1-(4-bromo-2,3-dichlorophenyl)tetrazol-5-yl]-N-ethylethanamine (PubChem CID 107794149) has the molecular formula C11H12BrCl2N5 and a molecular weight of 365.06 g/mol. Its IUPAC name is 1-[1-(4-bromo-2,3-dichlorophenyl)tetrazol-5-yl]-N-ethylethanamine.
| Compound Name | 1-[1-(4-bromo-2,3-dichlorophenyl)tetrazol-5-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 107794149 |
| Molecular Formula | C11H12BrCl2N5 |
| Molecular Weight | 365.06 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | 1-[1-(4-bromo-2,3-dichlorophenyl)tetrazol-5-yl]-N-ethylethanamine |
| SMILES | CCNC(C)c1nnnn1-c1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C11H12BrCl2N5/c1-3-15-6(2)11-16-17-18-19(11)8-5-4-7(12)9(13)10(8)14/h4-6,15H,3H2,1-2H3 |
| InChIKey | FAANGLQJECGLPT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.06 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|