C11H13F2N5 — CID 103085100
1-[1-(2,4-difluorophenyl)tetrazol-5-yl]-N-ethylethanamine (PubChem CID 103085100) has the molecular formula C11H13F2N5 and a molecular weight of 253.26 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)tetrazol-5-yl]-N-ethylethanamine.
| Compound Name | 1-[1-(2,4-difluorophenyl)tetrazol-5-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 103085100 |
| Molecular Formula | C11H13F2N5 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)tetrazol-5-yl]-N-ethylethanamine |
| SMILES | CCNC(C)c1nnnn1-c1ccc(F)cc1F |
| InChI | InChI=1S/C11H13F2N5/c1-3-14-7(2)11-15-16-17-18(11)10-5-4-8(12)6-9(10)13/h4-7,14H,3H2,1-2H3 |
| InChIKey | UEAUEQLEKACMBL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |