C12H14BrCl2N5O — CID 107794145
1-[1-(4-bromo-2,3-dichlorophenyl)tetrazol-5-yl]-N-(2-methoxyethyl)ethanamine (PubChem CID 107794145) has the molecular formula C12H14BrCl2N5O and a molecular weight of 395.09 g/mol. Its IUPAC name is 1-[1-(4-bromo-2,3-dichlorophenyl)tetrazol-5-yl]-N-(2-methoxyethyl)ethanamine.
| Compound Name | 1-[1-(4-bromo-2,3-dichlorophenyl)tetrazol-5-yl]-N-(2-methoxyethyl)ethanamine |
|---|---|
| PubChem CID | 107794145 |
| Molecular Formula | C12H14BrCl2N5O |
| Molecular Weight | 395.09 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | 1-[1-(4-bromo-2,3-dichlorophenyl)tetrazol-5-yl]-N-(2-methoxyethyl)ethanamine |
| SMILES | COCCNC(C)c1nnnn1-c1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C12H14BrCl2N5O/c1-7(16-5-6-21-2)12-17-18-19-20(12)9-4-3-8(13)10(14)11(9)15/h3-4,7,16H,5-6H2,1-2H3 |
| InChIKey | XAYXWSFEIIQWKB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.09 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|