C14H20ClN5O — CID 103085140
N-[1-[1-(4-chloro-2-methoxy-5-methylphenyl)tetrazol-5-yl]ethyl]propan-1-amine (PubChem CID 103085140) has the molecular formula C14H20ClN5O and a molecular weight of 309.80 g/mol. Its IUPAC name is N-[1-[1-(4-chloro-2-methoxy-5-methylphenyl)tetrazol-5-yl]ethyl]propan-1-amine.
| Compound Name | N-[1-[1-(4-chloro-2-methoxy-5-methylphenyl)tetrazol-5-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 103085140 |
| Molecular Formula | C14H20ClN5O |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | N-[1-[1-(4-chloro-2-methoxy-5-methylphenyl)tetrazol-5-yl]ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1nnnn1-c1cc(C)c(Cl)cc1OC |
| InChI | InChI=1S/C14H20ClN5O/c1-5-6-16-10(3)14-17-18-19-20(14)12-7-9(2)11(15)8-13(12)21-4/h7-8,10,16H,5-6H2,1-4H3 |
| InChIKey | UNHBIHLVFSKFHQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |