C12H16ClN5O — CID 62736292
N-[[1-(4-chloro-2-methoxy-5-methylphenyl)tetrazol-5-yl]methyl]ethanamine (PubChem CID 62736292) has the molecular formula C12H16ClN5O and a molecular weight of 281.75 g/mol. Its IUPAC name is N-[[1-(4-chloro-2-methoxy-5-methylphenyl)tetrazol-5-yl]methyl]ethanamine.
| Compound Name | N-[[1-(4-chloro-2-methoxy-5-methylphenyl)tetrazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 62736292 |
| Molecular Formula | C12H16ClN5O |
| Molecular Weight | 281.75 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-[[1-(4-chloro-2-methoxy-5-methylphenyl)tetrazol-5-yl]methyl]ethanamine |
| SMILES | CCNCc1nnnn1-c1cc(C)c(Cl)cc1OC |
| InChI | InChI=1S/C12H16ClN5O/c1-4-14-7-12-15-16-17-18(12)10-5-8(2)9(13)6-11(10)19-3/h5-6,14H,4,7H2,1-3H3 |
| InChIKey | QHTSFFIUEIXBNS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.75 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |