C11H14ClN5O2 — CID 82227998
2-[1-(4-chloro-2,5-dimethoxyphenyl)tetrazol-5-yl]ethanamine (PubChem CID 82227998) has the molecular formula C11H14ClN5O2 and a molecular weight of 283.72 g/mol. Its IUPAC name is 2-[1-(4-chloro-2,5-dimethoxyphenyl)tetrazol-5-yl]ethanamine.
| Compound Name | 2-[1-(4-chloro-2,5-dimethoxyphenyl)tetrazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 82227998 |
| Molecular Formula | C11H14ClN5O2 |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-[1-(4-chloro-2,5-dimethoxyphenyl)tetrazol-5-yl]ethanamine |
| SMILES | COc1cc(-n2nnnc2CCN)c(OC)cc1Cl |
| InChI | InChI=1S/C11H14ClN5O2/c1-18-9-6-8(10(19-2)5-7(9)12)17-11(3-4-13)14-15-16-17/h5-6H,3-4,13H2,1-2H3 |
| InChIKey | VAAZIVGTTCMWLC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |