C10H13N5O2 — CID 62737017
[1-(2,4-dimethoxyphenyl)tetrazol-5-yl]methanamine (PubChem CID 62737017) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is [1-(2,4-dimethoxyphenyl)tetrazol-5-yl]methanamine.
| Compound Name | [1-(2,4-dimethoxyphenyl)tetrazol-5-yl]methanamine |
|---|---|
| PubChem CID | 62737017 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | [1-(2,4-dimethoxyphenyl)tetrazol-5-yl]methanamine |
| SMILES | COc1ccc(-n2nnnc2CN)c(OC)c1 |
| InChI | InChI=1S/C10H13N5O2/c1-16-7-3-4-8(9(5-7)17-2)15-10(6-11)12-13-14-15/h3-5H,6,11H2,1-2H3 |
| InChIKey | JQHWNTRWCWVRLP-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |