C15H16N4O3 — CID 82197918
[1-(2,4-dimethoxyphenyl)-5-(furan-2-yl)triazol-4-yl]methanamine (PubChem CID 82197918) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is [1-(2,4-dimethoxyphenyl)-5-(furan-2-yl)triazol-4-yl]methanamine.
| Compound Name | [1-(2,4-dimethoxyphenyl)-5-(furan-2-yl)triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 82197918 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | [1-(2,4-dimethoxyphenyl)-5-(furan-2-yl)triazol-4-yl]methanamine |
| SMILES | COc1ccc(-n2nnc(CN)c2-c2ccco2)c(OC)c1 |
| InChI | InChI=1S/C15H16N4O3/c1-20-10-5-6-12(14(8-10)21-2)19-15(11(9-16)17-18-19)13-4-3-7-22-13/h3-8H,9,16H2,1-2H3 |
| InChIKey | SQVZWNRXPGZTSO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |