C14H19N3O3 — CID 82197872
[1-(2,4-dimethoxyphenyl)-5-propyltriazol-4-yl]methanol (PubChem CID 82197872) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is [1-(2,4-dimethoxyphenyl)-5-propyltriazol-4-yl]methanol.
| Compound Name | [1-(2,4-dimethoxyphenyl)-5-propyltriazol-4-yl]methanol |
|---|---|
| PubChem CID | 82197872 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | [1-(2,4-dimethoxyphenyl)-5-propyltriazol-4-yl]methanol |
| SMILES | CCCc1c(CO)nnn1-c1ccc(OC)cc1OC |
| InChI | InChI=1S/C14H19N3O3/c1-4-5-12-11(9-18)15-16-17(12)13-7-6-10(19-2)8-14(13)20-3/h6-8,18H,4-5,9H2,1-3H3 |
| InChIKey | MSXQDNIOQVBGEK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |