C14H16N4O2 — CID 82198630
1-(2,5-dimethoxyphenyl)-5-propyltriazole-4-carbonitrile (PubChem CID 82198630) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-5-propyltriazole-4-carbonitrile.
| Compound Name | 1-(2,5-dimethoxyphenyl)-5-propyltriazole-4-carbonitrile |
|---|---|
| PubChem CID | 82198630 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-5-propyltriazole-4-carbonitrile |
| SMILES | CCCc1c(C#N)nnn1-c1cc(OC)ccc1OC |
| InChI | InChI=1S/C14H16N4O2/c1-4-5-12-11(9-15)16-17-18(12)13-8-10(19-2)6-7-14(13)20-3/h6-8H,4-5H2,1-3H3 |
| InChIKey | TUVHOGABSOZIKE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 72.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |