C15H18N4O2 — CID 82197876
5-butyl-1-(2,4-dimethoxyphenyl)triazole-4-carbonitrile (PubChem CID 82197876) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is 5-butyl-1-(2,4-dimethoxyphenyl)triazole-4-carbonitrile.
| Compound Name | 5-butyl-1-(2,4-dimethoxyphenyl)triazole-4-carbonitrile |
|---|---|
| PubChem CID | 82197876 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 5-butyl-1-(2,4-dimethoxyphenyl)triazole-4-carbonitrile |
| SMILES | CCCCc1c(C#N)nnn1-c1ccc(OC)cc1OC |
| InChI | InChI=1S/C15H18N4O2/c1-4-5-6-13-12(10-16)17-18-19(13)14-8-7-11(20-2)9-15(14)21-3/h7-9H,4-6H2,1-3H3 |
| InChIKey | CAGYFCOHQNDHEW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 72.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |