C13H16ClN3O3 — CID 82197279
[1-(4-chloro-2,5-dimethoxyphenyl)-5-ethyltriazol-4-yl]methanol (PubChem CID 82197279) has the molecular formula C13H16ClN3O3 and a molecular weight of 297.74 g/mol. Its IUPAC name is [1-(4-chloro-2,5-dimethoxyphenyl)-5-ethyltriazol-4-yl]methanol.
| Compound Name | [1-(4-chloro-2,5-dimethoxyphenyl)-5-ethyltriazol-4-yl]methanol |
|---|---|
| PubChem CID | 82197279 |
| Molecular Formula | C13H16ClN3O3 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | [1-(4-chloro-2,5-dimethoxyphenyl)-5-ethyltriazol-4-yl]methanol |
| SMILES | CCc1c(CO)nnn1-c1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C13H16ClN3O3/c1-4-10-9(7-18)15-16-17(10)11-6-12(19-2)8(14)5-13(11)20-3/h5-6,18H,4,7H2,1-3H3 |
| InChIKey | WHAIJJHBOFWYON-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |