C12H14Cl2N4O — CID 83968020
2-[4-(3-chloro-4-methoxyphenyl)-5-(chloromethyl)-1,2,4-triazol-3-yl]ethanamine (PubChem CID 83968020) has the molecular formula C12H14Cl2N4O and a molecular weight of 301.18 g/mol. Its IUPAC name is 2-[4-(3-chloro-4-methoxyphenyl)-5-(chloromethyl)-1,2,4-triazol-3-yl]ethanamine.
| Compound Name | 2-[4-(3-chloro-4-methoxyphenyl)-5-(chloromethyl)-1,2,4-triazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 83968020 |
| Molecular Formula | C12H14Cl2N4O |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-[4-(3-chloro-4-methoxyphenyl)-5-(chloromethyl)-1,2,4-triazol-3-yl]ethanamine |
| SMILES | COc1ccc(-n2c(CCl)nnc2CCN)cc1Cl |
| InChI | InChI=1S/C12H14Cl2N4O/c1-19-10-3-2-8(6-9(10)14)18-11(4-5-15)16-17-12(18)7-13/h2-3,6H,4-5,7,15H2,1H3 |
| InChIKey | OZLJBQWQFICIHH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|